C32H60O4Sn2 — CID 177496437
9,9,20,20-tetrabutyl-8,10,19,21-tetraoxa-9,20-distannadispiro[5.5.512.56]docosa-3,15-diene (PubChem CID 177496437) has the molecular formula C32H60O4Sn2 and a molecular weight of 746.25 g/mol. Its IUPAC name is 9,9,20,20-tetrabutyl-8,10,19,21-tetraoxa-9,20-distannadispiro[5.5.512.56]docosa-3,15-diene.
| Compound Name | 9,9,20,20-tetrabutyl-8,10,19,21-tetraoxa-9,20-distannadispiro[5.5.512.56]docosa-3,15-diene |
|---|---|
| PubChem CID | 177496437 |
| Molecular Formula | C32H60O4Sn2 |
| Molecular Weight | 746.25 g/mol |
| Exact Mass | 748.25 |
| IUPAC Name | 9,9,20,20-tetrabutyl-8,10,19,21-tetraoxa-9,20-distannadispiro[5.5.512.56]docosa-3,15-diene |
| SMILES | CCCC[Sn]1(CCCC)OCC2(CC=CCC2)CO[Sn](CCCC)(CCCC)OCC2(CC=CCC2)CO1 |
| InChI | InChI=1S/2C8H12O2.4C4H9.2Sn/c2*9-6-8(7-10)4-2-1-3-5-8;4*1-3-4-2;;/h2*1-2H,3-7H2;4*1,3-4H2,2H3;;/q2*-2;;;;;2*+2 |
| InChIKey | ADNKXELUFVOREX-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.25 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|