C28H31NO10 — CID 177496457
methyl (1R,2R)-4-[(2R,4S,5R,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-2-ethyl-2,5,7-trihydroxy-6,11-dioxo-3,4-dihydro-1H-tetracene-1-carboxylate (PubChem CID 177496457) has the molecular formula C28H31NO10 and a molecular weight of 541.55 g/mol. Its IUPAC name is methyl (1R,2R)-4-[(2R,4S,5R,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-2-ethyl-2,5,7-trihydroxy-6,11-dioxo-3,4-dihydro-1H-tetracene-1-carboxylate.
| Compound Name | methyl (1R,2R)-4-[(2R,4S,5R,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-2-ethyl-2,5,7-trihydroxy-6,11-dioxo-3,4-dihydro-1H-tetracene-1-carboxylate |
|---|---|
| PubChem CID | 177496457 |
| Molecular Formula | C28H31NO10 |
| Molecular Weight | 541.55 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | methyl (1R,2R)-4-[(2R,4S,5R,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-2-ethyl-2,5,7-trihydroxy-6,11-dioxo-3,4-dihydro-1H-tetracene-1-carboxylate |
| SMILES | CC[C@@]1(O)CC(O[C@H]2C[C@H](N)[C@@H](O)[C@H](C)O2)c2c(cc3c(c2O)C(=O)c2c(O)cccc2C3=O)[C@H]1C(=O)OC |
| InChI | InChI=1S/C28H31NO10/c1-4-28(36)10-17(39-18-9-15(29)23(31)11(2)38-18)20-13(22(28)27(35)37-3)8-14-21(26(20)34)25(33)19-12(24(14)32)6-5-7-16(19)30/h5-8,11,15,17-18,22-23,30-31,34,36H,4,9-10,29H2,1-3H3/t11-,15-,17?,18-,22-,23-,28+/m0/s1 |
| InChIKey | MCWLCHNOMBKWNJ-YCOWQDMXSA-N |
| XLogP | 1.56 |
| TPSA | 185.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.55 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|