About [(1S,2R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethylsulfanylbenzene
[(1S,2R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethylsulfanylbenzene (PubChem CID 177496595) has the molecular formula C17H26OS
and a molecular weight of 278.46 g/mol. Its IUPAC name is [(1S,2R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethylsulfanylbenzene.
Molecular Properties
| Compound Name | [(1S,2R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethylsulfanylbenzene |
| PubChem CID | 177496595 |
| Molecular Formula | C17H26OS |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | [(1S,2R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethylsulfanylbenzene |
| SMILES | CC1CC[C@H](C(C)C)[C@@H](OCSc2ccccc2)C1 |
| InChI | InChI=1S/C17H26OS/c1-13(2)16-10-9-14(3)11-17(16)18-12-19-15-7-5-4-6-8-15/h4-8,13-14,16-17H,9-12H2,1-3H3/t14?,16-,17+/m1/s1 |
| InChIKey | XYRVQUZVRKMZAE-XMKPYSNPSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethylsulfanylbenzene?
The IUPAC name of [(1S,2R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethylsulfanylbenzene (CID 177496595) is [(1S,2R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethylsulfanylbenzene.
What is the SMILES notation for [(1S,2R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethylsulfanylbenzene?
The canonical SMILES for [(1S,2R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethylsulfanylbenzene is CC1CC[C@H](C(C)C)[C@@H](OCSc2ccccc2)C1.
What is the InChIKey of [(1S,2R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethylsulfanylbenzene?
The InChIKey is XYRVQUZVRKMZAE-XMKPYSNPSA-N. The full InChI is InChI=1S/C17H26OS/c1-13(2)16-10-9-14(3)11-17(16)18-12-19-15-7-5-4-6-8-15/h4-8,13-14,16-17H,9-12H2,1-3H3/t14?,16-,17+/m1/s1.
What are the key properties of [(1S,2R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethylsulfanylbenzene?
[(1S,2R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethylsulfanylbenzene has a molecular weight of 278.46 g/mol, XLogP of 5.21, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethylsulfanylbenzene is sourced from PubChem (CID 177496595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).