C47H26BF5N2 — CID 177496660
5-(2,3,4,5,6-pentafluorophenyl)-10,23,25-triphenyl-24,26-diaza-23-borahexacyclo[19.3.1.16,9.04,24.011,16.017,22]hexacosa-1(25),2,4,6(26),7,9,11,13,15,17(22),18,20-dodecaene (PubChem CID 177496660) has the molecular formula C47H26BF5N2 and a molecular weight of 724.54 g/mol. Its IUPAC name is 5-(2,3,4,5,6-pentafluorophenyl)-10,23,25-triphenyl-24,26-diaza-23-borahexacyclo[19.3.1.16,9.04,24.011,16.017,22]hexacosa-1(25),2,4,6(26),7,9,11,13,15,17(22),18,20-dodecaene.
| Compound Name | 5-(2,3,4,5,6-pentafluorophenyl)-10,23,25-triphenyl-24,26-diaza-23-borahexacyclo[19.3.1.16,9.04,24.011,16.017,22]hexacosa-1(25),2,4,6(26),7,9,11,13,15,17(22),18,20-dodecaene |
|---|---|
| PubChem CID | 177496660 |
| Molecular Formula | C47H26BF5N2 |
| Molecular Weight | 724.54 g/mol |
| Exact Mass | 724.21 |
| IUPAC Name | 5-(2,3,4,5,6-pentafluorophenyl)-10,23,25-triphenyl-24,26-diaza-23-borahexacyclo[19.3.1.16,9.04,24.011,16.017,22]hexacosa-1(25),2,4,6(26),7,9,11,13,15,17(22),18,20-dodecaene |
| SMILES | Fc1c(F)c(F)c(/C2=c3\ccc4n3B(c3ccccc3)c3c(cccc3-c3ccccc3/C(c3ccccc3)=C3/C=CC2=N3)C=4c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C47H26BF5N2/c49-43-41(44(50)46(52)47(53)45(43)51)40-35-24-23-34(54-35)38(27-13-4-1-5-14-27)31-20-11-10-19-30(31)32-21-12-22-33-39(28-15-6-2-7-16-28)36-25-26-37(40)55(36)48(42(32)33)29-17-8-3-9-18-29/h1-26H/b38-34-,40-37+ |
| InChIKey | IUPCEJQVVCBKAG-CLMKOASTSA-N |
| XLogP | 8.05 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.54 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|