C18H26N6 — CID 177497845
9-methyl-3,6,9,12,15,21-hexazatetracyclo[15.3.1.13,6.112,15]tricosa-1(21),4,13,17,19-pentaene (PubChem CID 177497845) has the molecular formula C18H26N6 and a molecular weight of 326.45 g/mol. Its IUPAC name is 9-methyl-3,6,9,12,15,21-hexazatetracyclo[15.3.1.13,6.112,15]tricosa-1(21),4,13,17,19-pentaene.
| Compound Name | 9-methyl-3,6,9,12,15,21-hexazatetracyclo[15.3.1.13,6.112,15]tricosa-1(21),4,13,17,19-pentaene |
|---|---|
| PubChem CID | 177497845 |
| Molecular Formula | C18H26N6 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 9-methyl-3,6,9,12,15,21-hexazatetracyclo[15.3.1.13,6.112,15]tricosa-1(21),4,13,17,19-pentaene |
| SMILES | CN1CCN2C=CN(Cc3cccc(n3)CN3C=CN(CC1)C3)C2 |
| InChI | InChI=1S/C18H26N6/c1-20-5-7-21-9-11-23(15-21)13-17-3-2-4-18(19-17)14-24-12-10-22(16-24)8-6-20/h2-4,9-12H,5-8,13-16H2,1H3 |
| InChIKey | CRCXOIKVFINZRC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 29.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |