About (3Z)-3-(3,7-dimethyloct-6-enylidene)oxolan-2-one
(3Z)-3-(3,7-dimethyloct-6-enylidene)oxolan-2-one (PubChem CID 177498079) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is (3Z)-3-(3,7-dimethyloct-6-enylidene)oxolan-2-one.
Molecular Properties
| Compound Name | (3Z)-3-(3,7-dimethyloct-6-enylidene)oxolan-2-one |
| PubChem CID | 177498079 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (3Z)-3-(3,7-dimethyloct-6-enylidene)oxolan-2-one |
| SMILES | CC(C)=CCCC(C)C/C=C1/CCOC1=O |
| InChI | InChI=1S/C14H22O2/c1-11(2)5-4-6-12(3)7-8-13-9-10-16-14(13)15/h5,8,12H,4,6-7,9-10H2,1-3H3/b13-8- |
| InChIKey | XEJKNMLKMBGFEZ-JYRVWZFOSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-(3,7-dimethyloct-6-enylidene)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-(3,7-dimethyloct-6-enylidene)oxolan-2-one?
The IUPAC name of (3Z)-3-(3,7-dimethyloct-6-enylidene)oxolan-2-one (CID 177498079) is (3Z)-3-(3,7-dimethyloct-6-enylidene)oxolan-2-one.
What is the SMILES notation for (3Z)-3-(3,7-dimethyloct-6-enylidene)oxolan-2-one?
The canonical SMILES for (3Z)-3-(3,7-dimethyloct-6-enylidene)oxolan-2-one is CC(C)=CCCC(C)C/C=C1/CCOC1=O.
What is the InChIKey of (3Z)-3-(3,7-dimethyloct-6-enylidene)oxolan-2-one?
The InChIKey is XEJKNMLKMBGFEZ-JYRVWZFOSA-N. The full InChI is InChI=1S/C14H22O2/c1-11(2)5-4-6-12(3)7-8-13-9-10-16-14(13)15/h5,8,12H,4,6-7,9-10H2,1-3H3/b13-8-.
What are the key properties of (3Z)-3-(3,7-dimethyloct-6-enylidene)oxolan-2-one?
(3Z)-3-(3,7-dimethyloct-6-enylidene)oxolan-2-one has a molecular weight of 222.33 g/mol, XLogP of 3.63, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-(3,7-dimethyloct-6-enylidene)oxolan-2-one is sourced from PubChem (CID 177498079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).