C14H22N2O2 — CID 177498507
(2S,3S,4R,5S)-2-[2-(2-cyclopenta-1,2,4-trien-1-ylethylamino)ethyl]-5-methylpyrrolidine-3,4-diol (PubChem CID 177498507) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2S,3S,4R,5S)-2-[2-(2-cyclopenta-1,2,4-trien-1-ylethylamino)ethyl]-5-methylpyrrolidine-3,4-diol.
| Compound Name | (2S,3S,4R,5S)-2-[2-(2-cyclopenta-1,2,4-trien-1-ylethylamino)ethyl]-5-methylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 177498507 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (2S,3S,4R,5S)-2-[2-(2-cyclopenta-1,2,4-trien-1-ylethylamino)ethyl]-5-methylpyrrolidine-3,4-diol |
| SMILES | C[C@@H]1N[C@@H](CCNCCC2=C=CC=C2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H22N2O2/c1-10-13(17)14(18)12(16-10)7-9-15-8-6-11-4-2-3-5-11/h2-4,10,12-18H,6-9H2,1H3/t10-,12-,13+,14-/m0/s1 |
| InChIKey | FWHRJJAINTVMBD-DEQVHRJGSA-N |
| XLogP | 0.09 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|