About methyl (E)-7-[(2S,3R)-2-ethenyl-4-oxoazetidin-3-yl]hept-2-enoate
methyl (E)-7-[(2S,3R)-2-ethenyl-4-oxoazetidin-3-yl]hept-2-enoate (PubChem CID 177498761) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is methyl (E)-7-[(2S,3R)-2-ethenyl-4-oxoazetidin-3-yl]hept-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-7-[(2S,3R)-2-ethenyl-4-oxoazetidin-3-yl]hept-2-enoate |
| PubChem CID | 177498761 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | methyl (E)-7-[(2S,3R)-2-ethenyl-4-oxoazetidin-3-yl]hept-2-enoate |
| SMILES | C=C[C@@H]1NC(=O)[C@@H]1CCCC/C=C/C(=O)OC |
| InChI | InChI=1S/C13H19NO3/c1-3-11-10(13(16)14-11)8-6-4-5-7-9-12(15)17-2/h3,7,9-11H,1,4-6,8H2,2H3,(H,14,16)/b9-7+/t10-,11+/m1/s1 |
| InChIKey | HSKNDDQKCAQADM-HDNGXNTCSA-N |
| XLogP | 1.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-7-[(2S,3R)-2-ethenyl-4-oxoazetidin-3-yl]hept-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-7-[(2S,3R)-2-ethenyl-4-oxoazetidin-3-yl]hept-2-enoate?
The IUPAC name of methyl (E)-7-[(2S,3R)-2-ethenyl-4-oxoazetidin-3-yl]hept-2-enoate (CID 177498761) is methyl (E)-7-[(2S,3R)-2-ethenyl-4-oxoazetidin-3-yl]hept-2-enoate.
What is the SMILES notation for methyl (E)-7-[(2S,3R)-2-ethenyl-4-oxoazetidin-3-yl]hept-2-enoate?
The canonical SMILES for methyl (E)-7-[(2S,3R)-2-ethenyl-4-oxoazetidin-3-yl]hept-2-enoate is C=C[C@@H]1NC(=O)[C@@H]1CCCC/C=C/C(=O)OC.
What is the InChIKey of methyl (E)-7-[(2S,3R)-2-ethenyl-4-oxoazetidin-3-yl]hept-2-enoate?
The InChIKey is HSKNDDQKCAQADM-HDNGXNTCSA-N. The full InChI is InChI=1S/C13H19NO3/c1-3-11-10(13(16)14-11)8-6-4-5-7-9-12(15)17-2/h3,7,9-11H,1,4-6,8H2,2H3,(H,14,16)/b9-7+/t10-,11+/m1/s1.
What are the key properties of methyl (E)-7-[(2S,3R)-2-ethenyl-4-oxoazetidin-3-yl]hept-2-enoate?
methyl (E)-7-[(2S,3R)-2-ethenyl-4-oxoazetidin-3-yl]hept-2-enoate has a molecular weight of 237.30 g/mol, XLogP of 1.58, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-7-[(2S,3R)-2-ethenyl-4-oxoazetidin-3-yl]hept-2-enoate is sourced from PubChem (CID 177498761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).