C29H34O6 — CID 177498913
(13S)-21-methoxy-5,13-diphenyl-3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(21),17,19-triene (PubChem CID 177498913) has the molecular formula C29H34O6 and a molecular weight of 478.59 g/mol. Its IUPAC name is (13S)-21-methoxy-5,13-diphenyl-3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(21),17,19-triene.
| Compound Name | (13S)-21-methoxy-5,13-diphenyl-3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(21),17,19-triene |
|---|---|
| PubChem CID | 177498913 |
| Molecular Formula | C29H34O6 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | (13S)-21-methoxy-5,13-diphenyl-3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(21),17,19-triene |
| SMILES | COc1c2cccc1COC[C@H](c1ccccc1)OCCOCCOC(c1ccccc1)COC2 |
| InChI | InChI=1S/C29H34O6/c1-30-29-25-13-8-14-26(29)20-33-22-28(24-11-6-3-7-12-24)35-18-16-31-15-17-34-27(21-32-19-25)23-9-4-2-5-10-23/h2-14,27-28H,15-22H2,1H3/t27-,28?/m1/s1 |
| InChIKey | YRUSTZHLEMPFGH-QXPUDEPPSA-N |
| XLogP | 5.27 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |