C66H78N2Sn — CID 177499080
1,3-bis[3,5-bis[2,6-di(propan-2-yl)phenyl]phenyl]-1,3,2λ2-benzodiazastannole (PubChem CID 177499080) has the molecular formula C66H78N2Sn and a molecular weight of 1018.07 g/mol. Its IUPAC name is 1,3-bis[3,5-bis[2,6-di(propan-2-yl)phenyl]phenyl]-1,3,2λ2-benzodiazastannole.
| Compound Name | 1,3-bis[3,5-bis[2,6-di(propan-2-yl)phenyl]phenyl]-1,3,2λ2-benzodiazastannole |
|---|---|
| PubChem CID | 177499080 |
| Molecular Formula | C66H78N2Sn |
| Molecular Weight | 1018.07 g/mol |
| Exact Mass | 1018.52 |
| IUPAC Name | 1,3-bis[3,5-bis[2,6-di(propan-2-yl)phenyl]phenyl]-1,3,2λ2-benzodiazastannole |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1cc(-c2c(C(C)C)cccc2C(C)C)cc(N2[Sn]N(c3cc(-c4c(C(C)C)cccc4C(C)C)cc(-c4c(C(C)C)cccc4C(C)C)c3)c3ccccc32)c1 |
| InChI | InChI=1S/C66H78N2.Sn/c1-39(2)53-23-19-24-54(40(3)4)63(53)47-33-48(64-55(41(5)6)25-20-26-56(64)42(7)8)36-51(35-47)67-61-31-17-18-32-62(61)68-52-37-49(65-57(43(9)10)27-21-28-58(65)44(11)12)34-50(38-52)66-59(45(13)14)29-22-30-60(66)46(15)16;/h17-46H,1-16H3;/q-2;+2 |
| InChIKey | HUWCFLFNSPFDTJ-UHFFFAOYSA-N |
| XLogP | 20.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1018.07 |
| LogP ≤ 5 | 20.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |