About 4-(4-methylphenyl)-2,4-bis(trimethylsilyloxy)butanenitrile
4-(4-methylphenyl)-2,4-bis(trimethylsilyloxy)butanenitrile (PubChem CID 177499309) has the molecular formula C17H29NO2Si2
and a molecular weight of 335.60 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2,4-bis(trimethylsilyloxy)butanenitrile.
Molecular Properties
| Compound Name | 4-(4-methylphenyl)-2,4-bis(trimethylsilyloxy)butanenitrile |
| PubChem CID | 177499309 |
| Molecular Formula | C17H29NO2Si2 |
| Molecular Weight | 335.60 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 4-(4-methylphenyl)-2,4-bis(trimethylsilyloxy)butanenitrile |
| SMILES | Cc1ccc(C(CC(C#N)O[Si](C)(C)C)O[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C17H29NO2Si2/c1-14-8-10-15(11-9-14)17(20-22(5,6)7)12-16(13-18)19-21(2,3)4/h8-11,16-17H,12H2,1-7H3 |
| InChIKey | XCZAUXGYNFVNEQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methylphenyl)-2,4-bis(trimethylsilyloxy)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylphenyl)-2,4-bis(trimethylsilyloxy)butanenitrile?
The IUPAC name of 4-(4-methylphenyl)-2,4-bis(trimethylsilyloxy)butanenitrile (CID 177499309) is 4-(4-methylphenyl)-2,4-bis(trimethylsilyloxy)butanenitrile.
What is the SMILES notation for 4-(4-methylphenyl)-2,4-bis(trimethylsilyloxy)butanenitrile?
The canonical SMILES for 4-(4-methylphenyl)-2,4-bis(trimethylsilyloxy)butanenitrile is Cc1ccc(C(CC(C#N)O[Si](C)(C)C)O[Si](C)(C)C)cc1.
What is the InChIKey of 4-(4-methylphenyl)-2,4-bis(trimethylsilyloxy)butanenitrile?
The InChIKey is XCZAUXGYNFVNEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NO2Si2/c1-14-8-10-15(11-9-14)17(20-22(5,6)7)12-16(13-18)19-21(2,3)4/h8-11,16-17H,12H2,1-7H3.
What are the key properties of 4-(4-methylphenyl)-2,4-bis(trimethylsilyloxy)butanenitrile?
4-(4-methylphenyl)-2,4-bis(trimethylsilyloxy)butanenitrile has a molecular weight of 335.60 g/mol, XLogP of 5.02, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylphenyl)-2,4-bis(trimethylsilyloxy)butanenitrile is sourced from PubChem (CID 177499309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).