C15H24F3NO4Si — CID 177499801
(3S,4S)-4-[(1R,3S)-3-methoxy-2-oxocyclohexyl]-3-[(1S)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]azetidin-2-one (PubChem CID 177499801) has the molecular formula C15H24F3NO4Si and a molecular weight of 367.44 g/mol. Its IUPAC name is (3S,4S)-4-[(1R,3S)-3-methoxy-2-oxocyclohexyl]-3-[(1S)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]azetidin-2-one.
| Compound Name | (3S,4S)-4-[(1R,3S)-3-methoxy-2-oxocyclohexyl]-3-[(1S)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]azetidin-2-one |
|---|---|
| PubChem CID | 177499801 |
| Molecular Formula | C15H24F3NO4Si |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (3S,4S)-4-[(1R,3S)-3-methoxy-2-oxocyclohexyl]-3-[(1S)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]azetidin-2-one |
| SMILES | CO[C@H]1CCC[C@H]([C@@H]2NC(=O)[C@@H]2[C@H](O[Si](C)(C)C)C(F)(F)F)C1=O |
| InChI | InChI=1S/C15H24F3NO4Si/c1-22-9-7-5-6-8(12(9)20)11-10(14(21)19-11)13(15(16,17)18)23-24(2,3)4/h8-11,13H,5-7H2,1-4H3,(H,19,21)/t8-,9+,10+,11+,13+/m1/s1 |
| InChIKey | RWIBERNCNCZNOC-XPCJQDJLSA-N |
| XLogP | 2.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|