C16H19FeN2O2- — CID 177499917
2-[3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzene-2-id-1-yl]-4,4-dimethyl-5H-1,3-oxazole;iron (PubChem CID 177499917) has the molecular formula C16H19FeN2O2- and a molecular weight of 327.19 g/mol. Its IUPAC name is 2-[3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzene-2-id-1-yl]-4,4-dimethyl-5H-1,3-oxazole;iron.
| Compound Name | 2-[3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzene-2-id-1-yl]-4,4-dimethyl-5H-1,3-oxazole;iron |
|---|---|
| PubChem CID | 177499917 |
| Molecular Formula | C16H19FeN2O2- |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-[3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzene-2-id-1-yl]-4,4-dimethyl-5H-1,3-oxazole;iron |
| SMILES | CC1(C)COC(c2[c-]c(C3=NC(C)(C)CO3)ccc2)=N1.[Fe] |
| InChI | InChI=1S/C16H19N2O2.Fe/c1-15(2)9-19-13(17-15)11-6-5-7-12(8-11)14-18-16(3,4)10-20-14;/h5-7H,9-10H2,1-4H3;/q-1; |
| InChIKey | CHGVYPQQCTYFQU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|