C23H18N4O4S — CID 17754339
(5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-(2-methyl-1,3-benzothiazol-5-yl)ethynyl]imidazolidine-2,4-dione (PubChem CID 17754339) has the molecular formula C23H18N4O4S and a molecular weight of 446.50 g/mol. Its IUPAC name is (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-(2-methyl-1,3-benzothiazol-5-yl)ethynyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-(2-methyl-1,3-benzothiazol-5-yl)ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 17754339 |
| Molecular Formula | C23H18N4O4S |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-(2-methyl-1,3-benzothiazol-5-yl)ethynyl]imidazolidine-2,4-dione |
| SMILES | CC1=NC2=C(S1)C=CC(=C2)C#C[C@]3(C(=O)NC(=O)N3)CN4CC5=C(C4=O)C=C(C=C5)OC |
| InChI | InChI=1S/C23H18N4O4S/c1-13-24-18-9-14(3-6-19(18)32-13)7-8-23(21(29)25-22(30)26-23)12-27-11-15-4-5-16(31-2)10-17(15)20(27)28/h3-6,9-10H,11-12H2,1-2H3,(H2,25,26,29,30)/t23-/m1/s1 |
| InChIKey | BPWRHOMCAGJMTA-HSZRJFAPSA-N |
| XLogP | 2.40 |
| TPSA | 129.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | 884 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|