C8H6Br4 — CID 17771
1,2,3,4-tetrabromo-5,6-dimethylbenzene (PubChem CID 17771) has the molecular formula C8H6Br4 and a molecular weight of 421.75 g/mol. Its IUPAC name is 1,2,3,4-tetrabromo-5,6-dimethylbenzene.
| Compound Name | 1,2,3,4-tetrabromo-5,6-dimethylbenzene |
|---|---|
| PubChem CID | 17771 |
| Molecular Formula | C8H6Br4 |
| Molecular Weight | 421.75 g/mol |
| Exact Mass | 417.72 |
| IUPAC Name | 1,2,3,4-tetrabromo-5,6-dimethylbenzene |
| SMILES | Cc1c(C)c(Br)c(Br)c(Br)c1Br |
| InChI | InChI=1S/C8H6Br4/c1-3-4(2)6(10)8(12)7(11)5(3)9/h1-2H3 |
| InChIKey | WVJRAJZMOVQFEC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.75 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|