C11H16O — CID 17783
2,3,4,5,6-pentamethylphenol (PubChem CID 17783) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethylphenol.
| Compound Name | 2,3,4,5,6-pentamethylphenol |
|---|---|
| PubChem CID | 17783 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 2,3,4,5,6-pentamethylphenol |
| SMILES | Cc1c(C)c(C)c(O)c(C)c1C |
| InChI | InChI=1S/C11H16O/c1-6-7(2)9(4)11(12)10(5)8(6)3/h12H,1-5H3 |
| InChIKey | WALBTDFSFTVXII-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |