About 1-(2-methylbenzene-4-id-1-yl)-1,3-diazinane-2,4-dione;tungsten
1-(2-methylbenzene-4-id-1-yl)-1,3-diazinane-2,4-dione;tungsten (PubChem CID 178000620) has the molecular formula C11H11N2O2W-
and a molecular weight of 387.06 g/mol. Its IUPAC name is 1-(2-methylbenzene-4-id-1-yl)-1,3-diazinane-2,4-dione;tungsten.
Molecular Properties
| Compound Name | 1-(2-methylbenzene-4-id-1-yl)-1,3-diazinane-2,4-dione;tungsten |
| PubChem CID | 178000620 |
| Molecular Formula | C11H11N2O2W- |
| Molecular Weight | 387.06 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 1-(2-methylbenzene-4-id-1-yl)-1,3-diazinane-2,4-dione;tungsten |
| SMILES | Cc1c[c-]ccc1N1CCC(=O)NC1=O.[W] |
| InChI | InChI=1S/C11H11N2O2.W/c1-8-4-2-3-5-9(8)13-7-6-10(14)12-11(13)15;/h3-5H,6-7H2,1H3,(H,12,14,15);/q-1; |
| InChIKey | GKQGDXMIRDTOMG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.06 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methylbenzene-4-id-1-yl)-1,3-diazinane-2,4-dione;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylbenzene-4-id-1-yl)-1,3-diazinane-2,4-dione;tungsten?
The IUPAC name of 1-(2-methylbenzene-4-id-1-yl)-1,3-diazinane-2,4-dione;tungsten (CID 178000620) is 1-(2-methylbenzene-4-id-1-yl)-1,3-diazinane-2,4-dione;tungsten.
What is the SMILES notation for 1-(2-methylbenzene-4-id-1-yl)-1,3-diazinane-2,4-dione;tungsten?
The canonical SMILES for 1-(2-methylbenzene-4-id-1-yl)-1,3-diazinane-2,4-dione;tungsten is Cc1c[c-]ccc1N1CCC(=O)NC1=O.[W].
What is the InChIKey of 1-(2-methylbenzene-4-id-1-yl)-1,3-diazinane-2,4-dione;tungsten?
The InChIKey is GKQGDXMIRDTOMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N2O2.W/c1-8-4-2-3-5-9(8)13-7-6-10(14)12-11(13)15;/h3-5H,6-7H2,1H3,(H,12,14,15);/q-1;.
What are the key properties of 1-(2-methylbenzene-4-id-1-yl)-1,3-diazinane-2,4-dione;tungsten?
1-(2-methylbenzene-4-id-1-yl)-1,3-diazinane-2,4-dione;tungsten has a molecular weight of 387.06 g/mol, XLogP of 1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylbenzene-4-id-1-yl)-1,3-diazinane-2,4-dione;tungsten is sourced from PubChem (CID 178000620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).