C21H28FN9O — CID 178000689
2-N-[3-fluoro-1-(2-methoxyethyl)piperidin-4-yl]-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 178000689) has the molecular formula C21H28FN9O and a molecular weight of 441.52 g/mol. Its IUPAC name is 2-N-[3-fluoro-1-(2-methoxyethyl)piperidin-4-yl]-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 2-N-[3-fluoro-1-(2-methoxyethyl)piperidin-4-yl]-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 178000689 |
| Molecular Formula | C21H28FN9O |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 2-N-[3-fluoro-1-(2-methoxyethyl)piperidin-4-yl]-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | C/N=N/c1ccc(-c2ccn3nc(NC4CCN(CCOC)CC4F)nc(N)c23)nc1C |
| InChI | InChI=1S/C21H28FN9O/c1-13-16(28-24-2)4-5-17(25-13)14-6-9-31-19(14)20(23)27-21(29-31)26-18-7-8-30(10-11-32-3)12-15(18)22/h4-6,9,15,18H,7-8,10-12H2,1-3H3,(H3,23,26,27,29)/b28-24+ |
| InChIKey | SZGIRYQKPIBPMO-ZZIIXHQDSA-N |
| XLogP | 2.87 |
| TPSA | 118.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|