C20H24F3N9O — CID 178000972
5-[3-(2,2-difluoroethyl)triazolo[4,5-b]pyridin-5-yl]-6-fluoropyrrolo[2,1-f][1,2,4]triazine-2,4-diamine;1-methylcyclohexan-1-ol (PubChem CID 178000972) has the molecular formula C20H24F3N9O and a molecular weight of 463.47 g/mol. Its IUPAC name is 5-[3-(2,2-difluoroethyl)triazolo[4,5-b]pyridin-5-yl]-6-fluoropyrrolo[2,1-f][1,2,4]triazine-2,4-diamine;1-methylcyclohexan-1-ol.
| Compound Name | 5-[3-(2,2-difluoroethyl)triazolo[4,5-b]pyridin-5-yl]-6-fluoropyrrolo[2,1-f][1,2,4]triazine-2,4-diamine;1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 178000972 |
| Molecular Formula | C20H24F3N9O |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 5-[3-(2,2-difluoroethyl)triazolo[4,5-b]pyridin-5-yl]-6-fluoropyrrolo[2,1-f][1,2,4]triazine-2,4-diamine;1-methylcyclohexan-1-ol |
| SMILES | CC1(O)CCCCC1.Nc1nc(N)c2c(-c3ccc4nnn(CC(F)F)c4n3)c(F)cn2n1 |
| InChI | InChI=1S/C13H10F3N9.C7H14O/c14-5-3-24-10(11(17)20-13(18)22-24)9(5)6-1-2-7-12(19-6)25(23-21-7)4-8(15)16;1-7(8)5-3-2-4-6-7/h1-3,8H,4H2,(H4,17,18,20,22);8H,2-6H2,1H3 |
| InChIKey | NPCSOXONDLSDRO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 146.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |