C14H14FN9 — CID 178001056
5-[3-(2-fluoroethyl)triazolo[4,5-b]pyridin-5-yl]-4-N-methylpyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 178001056) has the molecular formula C14H14FN9 and a molecular weight of 327.33 g/mol. Its IUPAC name is 5-[3-(2-fluoroethyl)triazolo[4,5-b]pyridin-5-yl]-4-N-methylpyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 5-[3-(2-fluoroethyl)triazolo[4,5-b]pyridin-5-yl]-4-N-methylpyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 178001056 |
| Molecular Formula | C14H14FN9 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 5-[3-(2-fluoroethyl)triazolo[4,5-b]pyridin-5-yl]-4-N-methylpyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | CNc1nc(N)nn2ccc(-c3ccc4nnn(CCF)c4n3)c12 |
| InChI | InChI=1S/C14H14FN9/c1-17-12-11-8(4-6-23(11)21-14(16)19-12)9-2-3-10-13(18-9)24(7-5-15)22-20-10/h2-4,6H,5,7H2,1H3,(H3,16,17,19,21) |
| InChIKey | CYGNETOSPAJRST-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 111.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |