C22H25F2N9O — CID 178001107
N-[(3S)-3-[[5-[3-(2,2-difluoroethyl)imidazo[1,2-b]pyridazin-6-yl]-4-(methylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclopentyl]acetamide (PubChem CID 178001107) has the molecular formula C22H25F2N9O and a molecular weight of 469.50 g/mol. Its IUPAC name is N-[(3S)-3-[[5-[3-(2,2-difluoroethyl)imidazo[1,2-b]pyridazin-6-yl]-4-(methylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclopentyl]acetamide.
| Compound Name | N-[(3S)-3-[[5-[3-(2,2-difluoroethyl)imidazo[1,2-b]pyridazin-6-yl]-4-(methylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclopentyl]acetamide |
|---|---|
| PubChem CID | 178001107 |
| Molecular Formula | C22H25F2N9O |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | N-[(3S)-3-[[5-[3-(2,2-difluoroethyl)imidazo[1,2-b]pyridazin-6-yl]-4-(methylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclopentyl]acetamide |
| SMILES | CNc1nc(N[C@H]2CCC(NC(C)=O)C2)nn2ccc(-c3ccc4ncc(CC(F)F)n4n3)c12 |
| InChI | InChI=1S/C22H25F2N9O/c1-12(34)27-13-3-4-14(9-13)28-22-29-21(25-2)20-16(7-8-32(20)31-22)17-5-6-19-26-11-15(10-18(23)24)33(19)30-17/h5-8,11,13-14,18H,3-4,9-10H2,1-2H3,(H,27,34)(H2,25,28,29,31)/t13?,14-/m0/s1 |
| InChIKey | SKMKPJBCRIPVBU-KZUDCZAMSA-N |
| XLogP | 2.76 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |