About 6-(4-ethylpiperidin-1-yl)-3-methyl-3,4-dihydropyridine;methane
6-(4-ethylpiperidin-1-yl)-3-methyl-3,4-dihydropyridine;methane (PubChem CID 178001646) has the molecular formula C14H26N2
and a molecular weight of 222.38 g/mol. Its IUPAC name is 6-(4-ethylpiperidin-1-yl)-3-methyl-3,4-dihydropyridine;methane.
Molecular Properties
| Compound Name | 6-(4-ethylpiperidin-1-yl)-3-methyl-3,4-dihydropyridine;methane |
| PubChem CID | 178001646 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 6-(4-ethylpiperidin-1-yl)-3-methyl-3,4-dihydropyridine;methane |
| SMILES | C.CCC1CCN(C2=CCC(C)C=N2)CC1 |
| InChI | InChI=1S/C13H22N2.CH4/c1-3-12-6-8-15(9-7-12)13-5-4-11(2)10-14-13;/h5,10-12H,3-4,6-9H2,1-2H3;1H4 |
| InChIKey | UCOUPDBJCAXTHE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(4-ethylpiperidin-1-yl)-3-methyl-3,4-dihydropyridine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-ethylpiperidin-1-yl)-3-methyl-3,4-dihydropyridine;methane?
The IUPAC name of 6-(4-ethylpiperidin-1-yl)-3-methyl-3,4-dihydropyridine;methane (CID 178001646) is 6-(4-ethylpiperidin-1-yl)-3-methyl-3,4-dihydropyridine;methane.
What is the SMILES notation for 6-(4-ethylpiperidin-1-yl)-3-methyl-3,4-dihydropyridine;methane?
The canonical SMILES for 6-(4-ethylpiperidin-1-yl)-3-methyl-3,4-dihydropyridine;methane is C.CCC1CCN(C2=CCC(C)C=N2)CC1.
What is the InChIKey of 6-(4-ethylpiperidin-1-yl)-3-methyl-3,4-dihydropyridine;methane?
The InChIKey is UCOUPDBJCAXTHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2.CH4/c1-3-12-6-8-15(9-7-12)13-5-4-11(2)10-14-13;/h5,10-12H,3-4,6-9H2,1-2H3;1H4.
What are the key properties of 6-(4-ethylpiperidin-1-yl)-3-methyl-3,4-dihydropyridine;methane?
6-(4-ethylpiperidin-1-yl)-3-methyl-3,4-dihydropyridine;methane has a molecular weight of 222.38 g/mol, XLogP of 3.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-ethylpiperidin-1-yl)-3-methyl-3,4-dihydropyridine;methane is sourced from PubChem (CID 178001646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).