C14H14ClF3N2O — CID 178002732
2-chloro-1-[(3R,4S)-3-methyloxan-4-yl]-5-(trifluoromethyl)benzimidazole (PubChem CID 178002732) has the molecular formula C14H14ClF3N2O and a molecular weight of 318.73 g/mol. Its IUPAC name is 2-chloro-1-[(3R,4S)-3-methyloxan-4-yl]-5-(trifluoromethyl)benzimidazole.
| Compound Name | 2-chloro-1-[(3R,4S)-3-methyloxan-4-yl]-5-(trifluoromethyl)benzimidazole |
|---|---|
| PubChem CID | 178002732 |
| Molecular Formula | C14H14ClF3N2O |
| Molecular Weight | 318.73 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-chloro-1-[(3R,4S)-3-methyloxan-4-yl]-5-(trifluoromethyl)benzimidazole |
| SMILES | C[C@H]1COCC[C@@H]1n1c(Cl)nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C14H14ClF3N2O/c1-8-7-21-5-4-11(8)20-12-3-2-9(14(16,17)18)6-10(12)19-13(20)15/h2-3,6,8,11H,4-5,7H2,1H3/t8-,11-/m0/s1 |
| InChIKey | ZYAWLNMZCMTGQI-KWQFWETISA-N |
| XLogP | 4.31 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.73 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |