About [2-(2,7-ditert-butyl-9H-fluoren-9-yl)phenyl]-imino-dimethyl-λ5-phosphane
[2-(2,7-ditert-butyl-9H-fluoren-9-yl)phenyl]-imino-dimethyl-λ5-phosphane (PubChem CID 178003983) has the molecular formula C29H36NP
and a molecular weight of 429.59 g/mol. Its IUPAC name is [2-(2,7-ditert-butyl-9H-fluoren-9-yl)phenyl]-imino-dimethyl-λ5-phosphane.
Molecular Properties
| Compound Name | [2-(2,7-ditert-butyl-9H-fluoren-9-yl)phenyl]-imino-dimethyl-λ5-phosphane |
| PubChem CID | 178003983 |
| Molecular Formula | C29H36NP |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | [2-(2,7-ditert-butyl-9H-fluoren-9-yl)phenyl]-imino-dimethyl-λ5-phosphane |
| SMILES | [H]N=P(C)(C)c1ccccc1C1c2cc(C(C)(C)C)ccc2-c2ccc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C29H36NP/c1-28(2,3)19-13-15-21-22-16-14-20(29(4,5)6)18-25(22)27(24(21)17-19)23-11-9-10-12-26(23)31(7,8)30/h9-18,27,30H,1-8H3 |
| InChIKey | YRIJYLOUMFVYMV-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,7-ditert-butyl-9H-fluoren-9-yl)phenyl]-imino-dimethyl-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,7-ditert-butyl-9H-fluoren-9-yl)phenyl]-imino-dimethyl-λ5-phosphane?
The IUPAC name of [2-(2,7-ditert-butyl-9H-fluoren-9-yl)phenyl]-imino-dimethyl-λ5-phosphane (CID 178003983) is [2-(2,7-ditert-butyl-9H-fluoren-9-yl)phenyl]-imino-dimethyl-λ5-phosphane.
What is the SMILES notation for [2-(2,7-ditert-butyl-9H-fluoren-9-yl)phenyl]-imino-dimethyl-λ5-phosphane?
The canonical SMILES for [2-(2,7-ditert-butyl-9H-fluoren-9-yl)phenyl]-imino-dimethyl-λ5-phosphane is [H]N=P(C)(C)c1ccccc1C1c2cc(C(C)(C)C)ccc2-c2ccc(C(C)(C)C)cc21.
What is the InChIKey of [2-(2,7-ditert-butyl-9H-fluoren-9-yl)phenyl]-imino-dimethyl-λ5-phosphane?
The InChIKey is YRIJYLOUMFVYMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H36NP/c1-28(2,3)19-13-15-21-22-16-14-20(29(4,5)6)18-25(22)27(24(21)17-19)23-11-9-10-12-26(23)31(7,8)30/h9-18,27,30H,1-8H3.
What are the key properties of [2-(2,7-ditert-butyl-9H-fluoren-9-yl)phenyl]-imino-dimethyl-λ5-phosphane?
[2-(2,7-ditert-butyl-9H-fluoren-9-yl)phenyl]-imino-dimethyl-λ5-phosphane has a molecular weight of 429.59 g/mol, XLogP of 8.11, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,7-ditert-butyl-9H-fluoren-9-yl)phenyl]-imino-dimethyl-λ5-phosphane is sourced from PubChem (CID 178003983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).