C24H33N3O10 — CID 178004588
2-[4-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethylamino]-2-oxoethoxy]-1,3-dioxoisoindol-2-yl]-N-methyl-5-oxopentanamide (PubChem CID 178004588) has the molecular formula C24H33N3O10 and a molecular weight of 523.54 g/mol. Its IUPAC name is 2-[4-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethylamino]-2-oxoethoxy]-1,3-dioxoisoindol-2-yl]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[4-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethylamino]-2-oxoethoxy]-1,3-dioxoisoindol-2-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 178004588 |
| Molecular Formula | C24H33N3O10 |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | 2-[4-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethylamino]-2-oxoethoxy]-1,3-dioxoisoindol-2-yl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)N1C(=O)c2cccc(OCC(=O)NCCOCCOCCOCCO)c2C1=O |
| InChI | InChI=1S/C24H33N3O10/c1-25-22(31)18(5-3-8-28)27-23(32)17-4-2-6-19(21(17)24(27)33)37-16-20(30)26-7-10-34-12-14-36-15-13-35-11-9-29/h2,4,6,8,18,29H,3,5,7,9-16H2,1H3,(H,25,31)(H,26,30) |
| InChIKey | SHWNVTMJCROJNQ-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 169.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|