About 3,5-di(propan-2-yl)benzonitrile;2,4-di(propan-2-yl)-1-(trifluoromethyl)benzene;ethane
3,5-di(propan-2-yl)benzonitrile;2,4-di(propan-2-yl)-1-(trifluoromethyl)benzene;ethane (PubChem CID 178004660) has the molecular formula C28H40F3N
and a molecular weight of 447.63 g/mol. Its IUPAC name is 3,5-di(propan-2-yl)benzonitrile;2,4-di(propan-2-yl)-1-(trifluoromethyl)benzene;ethane.
Molecular Properties
| Compound Name | 3,5-di(propan-2-yl)benzonitrile;2,4-di(propan-2-yl)-1-(trifluoromethyl)benzene;ethane |
| PubChem CID | 178004660 |
| Molecular Formula | C28H40F3N |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | 3,5-di(propan-2-yl)benzonitrile;2,4-di(propan-2-yl)-1-(trifluoromethyl)benzene;ethane |
| SMILES | CC.CC(C)c1cc(C#N)cc(C(C)C)c1.CC(C)c1ccc(C(F)(F)F)c(C(C)C)c1 |
| InChI | InChI=1S/C13H17F3.C13H17N.C2H6/c1-8(2)10-5-6-12(13(14,15)16)11(7-10)9(3)4;1-9(2)12-5-11(8-14)6-13(7-12)10(3)4;1-2/h5-9H,1-4H3;5-7,9-10H,1-4H3;1-2H3 |
| InChIKey | UFKQYUNLBSPOAC-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-di(propan-2-yl)benzonitrile;2,4-di(propan-2-yl)-1-(trifluoromethyl)benzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-di(propan-2-yl)benzonitrile;2,4-di(propan-2-yl)-1-(trifluoromethyl)benzene;ethane?
The IUPAC name of 3,5-di(propan-2-yl)benzonitrile;2,4-di(propan-2-yl)-1-(trifluoromethyl)benzene;ethane (CID 178004660) is 3,5-di(propan-2-yl)benzonitrile;2,4-di(propan-2-yl)-1-(trifluoromethyl)benzene;ethane.
What is the SMILES notation for 3,5-di(propan-2-yl)benzonitrile;2,4-di(propan-2-yl)-1-(trifluoromethyl)benzene;ethane?
The canonical SMILES for 3,5-di(propan-2-yl)benzonitrile;2,4-di(propan-2-yl)-1-(trifluoromethyl)benzene;ethane is CC.CC(C)c1cc(C#N)cc(C(C)C)c1.CC(C)c1ccc(C(F)(F)F)c(C(C)C)c1.
What is the InChIKey of 3,5-di(propan-2-yl)benzonitrile;2,4-di(propan-2-yl)-1-(trifluoromethyl)benzene;ethane?
The InChIKey is UFKQYUNLBSPOAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F3.C13H17N.C2H6/c1-8(2)10-5-6-12(13(14,15)16)11(7-10)9(3)4;1-9(2)12-5-11(8-14)6-13(7-12)10(3)4;1-2/h5-9H,1-4H3;5-7,9-10H,1-4H3;1-2H3.
What are the key properties of 3,5-di(propan-2-yl)benzonitrile;2,4-di(propan-2-yl)-1-(trifluoromethyl)benzene;ethane?
3,5-di(propan-2-yl)benzonitrile;2,4-di(propan-2-yl)-1-(trifluoromethyl)benzene;ethane has a molecular weight of 447.63 g/mol, XLogP of 9.78, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-di(propan-2-yl)benzonitrile;2,4-di(propan-2-yl)-1-(trifluoromethyl)benzene;ethane is sourced from PubChem (CID 178004660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).