C39H47N9O3 — CID 178005232
7-cyclopentyl-2-[[5-[[2-[4-(2,6-dioxopiperidin-3-yl)phenyl]-2,8-diazaspiro[4.5]decan-8-yl]methyl]-2-pyridinyl]amino]-N,N-dimethylpyrrolo[2,3-d]pyrimidine-6-carboxamide (PubChem CID 178005232) has the molecular formula C39H47N9O3 and a molecular weight of 689.87 g/mol. Its IUPAC name is 7-cyclopentyl-2-[[5-[[2-[4-(2,6-dioxopiperidin-3-yl)phenyl]-2,8-diazaspiro[4.5]decan-8-yl]methyl]-2-pyridinyl]amino]-N,N-dimethylpyrrolo[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 7-cyclopentyl-2-[[5-[[2-[4-(2,6-dioxopiperidin-3-yl)phenyl]-2,8-diazaspiro[4.5]decan-8-yl]methyl]-2-pyridinyl]amino]-N,N-dimethylpyrrolo[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 178005232 |
| Molecular Formula | C39H47N9O3 |
| Molecular Weight | 689.87 g/mol |
| Exact Mass | 689.38 |
| IUPAC Name | 7-cyclopentyl-2-[[5-[[2-[4-(2,6-dioxopiperidin-3-yl)phenyl]-2,8-diazaspiro[4.5]decan-8-yl]methyl]-2-pyridinyl]amino]-N,N-dimethylpyrrolo[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CN(C)C(=O)c1cc2cnc(Nc3ccc(CN4CCC5(CC4)CCN(c4ccc(C6CCC(=O)NC6=O)cc4)C5)cn3)nc2n1C1CCCC1 |
| InChI | InChI=1S/C39H47N9O3/c1-45(2)37(51)32-21-28-23-41-38(44-35(28)48(32)30-5-3-4-6-30)42-33-13-7-26(22-40-33)24-46-18-15-39(16-19-46)17-20-47(25-39)29-10-8-27(9-11-29)31-12-14-34(49)43-36(31)50/h7-11,13,21-23,30-31H,3-6,12,14-20,24-25H2,1-2H3,(H,43,49,50)(H,40,41,42,44) |
| InChIKey | OQIDGSALOLUPBD-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.87 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|