About (3Z)-1-cyclopentyl-3-ethylidenepyrrol-2-imine;N,N-dimethylacetamide
(3Z)-1-cyclopentyl-3-ethylidenepyrrol-2-imine;N,N-dimethylacetamide (PubChem CID 178005419) has the molecular formula C15H25N3O
and a molecular weight of 263.38 g/mol. Its IUPAC name is (3Z)-1-cyclopentyl-3-ethylidenepyrrol-2-imine;N,N-dimethylacetamide.
Molecular Properties
| Compound Name | (3Z)-1-cyclopentyl-3-ethylidenepyrrol-2-imine;N,N-dimethylacetamide |
| PubChem CID | 178005419 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | (3Z)-1-cyclopentyl-3-ethylidenepyrrol-2-imine;N,N-dimethylacetamide |
| SMILES | CC(=O)N(C)C.[H]/N=C1C(=C/C)\C=CN\1C1CCCC1 |
| InChI | InChI=1S/C11H16N2.C4H9NO/c1-2-9-7-8-13(11(9)12)10-5-3-4-6-10;1-4(6)5(2)3/h2,7-8,10,12H,3-6H2,1H3;1-3H3/b9-2-,12-11+; |
| InChIKey | HTKZUZBOANDGNR-NYOBTUIVSA-N |
| XLogP | 2.78 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-1-cyclopentyl-3-ethylidenepyrrol-2-imine;N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-1-cyclopentyl-3-ethylidenepyrrol-2-imine;N,N-dimethylacetamide?
The IUPAC name of (3Z)-1-cyclopentyl-3-ethylidenepyrrol-2-imine;N,N-dimethylacetamide (CID 178005419) is (3Z)-1-cyclopentyl-3-ethylidenepyrrol-2-imine;N,N-dimethylacetamide.
What is the SMILES notation for (3Z)-1-cyclopentyl-3-ethylidenepyrrol-2-imine;N,N-dimethylacetamide?
The canonical SMILES for (3Z)-1-cyclopentyl-3-ethylidenepyrrol-2-imine;N,N-dimethylacetamide is CC(=O)N(C)C.[H]/N=C1C(=C/C)\C=CN\1C1CCCC1.
What is the InChIKey of (3Z)-1-cyclopentyl-3-ethylidenepyrrol-2-imine;N,N-dimethylacetamide?
The InChIKey is HTKZUZBOANDGNR-NYOBTUIVSA-N. The full InChI is InChI=1S/C11H16N2.C4H9NO/c1-2-9-7-8-13(11(9)12)10-5-3-4-6-10;1-4(6)5(2)3/h2,7-8,10,12H,3-6H2,1H3;1-3H3/b9-2-,12-11+;.
What are the key properties of (3Z)-1-cyclopentyl-3-ethylidenepyrrol-2-imine;N,N-dimethylacetamide?
(3Z)-1-cyclopentyl-3-ethylidenepyrrol-2-imine;N,N-dimethylacetamide has a molecular weight of 263.38 g/mol, XLogP of 2.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-1-cyclopentyl-3-ethylidenepyrrol-2-imine;N,N-dimethylacetamide is sourced from PubChem (CID 178005419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).