C8H15FO — CID 178006213
(4R,5R)-5-fluoro-2,2,4-trimethyloxane (PubChem CID 178006213) has the molecular formula C8H15FO and a molecular weight of 146.20 g/mol. Its IUPAC name is (4R,5R)-5-fluoro-2,2,4-trimethyloxane.
| Compound Name | (4R,5R)-5-fluoro-2,2,4-trimethyloxane |
|---|---|
| PubChem CID | 178006213 |
| Molecular Formula | C8H15FO |
| Molecular Weight | 146.20 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (4R,5R)-5-fluoro-2,2,4-trimethyloxane |
| SMILES | C[C@@H]1CC(C)(C)OC[C@@H]1F |
| InChI | InChI=1S/C8H15FO/c1-6-4-8(2,3)10-5-7(6)9/h6-7H,4-5H2,1-3H3/t6-,7+/m1/s1 |
| InChIKey | PRZXFTQMDPVRBK-RQJHMYQMSA-N |
| XLogP | 2.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |