C34H46F3N5O4S — CID 178006523
pentyl 2-[(2R)-4-[2-[4-[3-[4-amino-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2-ethylphenoxy]ethyl]-2-methylpiperazin-1-yl]acetate (PubChem CID 178006523) has the molecular formula C34H46F3N5O4S and a molecular weight of 677.83 g/mol. Its IUPAC name is pentyl 2-[(2R)-4-[2-[4-[3-[4-amino-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2-ethylphenoxy]ethyl]-2-methylpiperazin-1-yl]acetate.
| Compound Name | pentyl 2-[(2R)-4-[2-[4-[3-[4-amino-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2-ethylphenoxy]ethyl]-2-methylpiperazin-1-yl]acetate |
|---|---|
| PubChem CID | 178006523 |
| Molecular Formula | C34H46F3N5O4S |
| Molecular Weight | 677.83 g/mol |
| Exact Mass | 677.32 |
| IUPAC Name | pentyl 2-[(2R)-4-[2-[4-[3-[4-amino-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2-ethylphenoxy]ethyl]-2-methylpiperazin-1-yl]acetate |
| SMILES | CCCCCOC(=O)CN1CCN(CCOc2ccc(N3C(=S)N(c4ccc(N)c(C(F)(F)F)c4)C(=O)C3(C)C)cc2CC)C[C@H]1C |
| InChI | InChI=1S/C34H46F3N5O4S/c1-6-8-9-17-46-30(43)22-40-15-14-39(21-23(40)3)16-18-45-29-13-11-26(19-24(29)7-2)42-32(47)41(31(44)33(42,4)5)25-10-12-28(38)27(20-25)34(35,36)37/h10-13,19-20,23H,6-9,14-18,21-22,38H2,1-5H3/t23-/m1/s1 |
| InChIKey | RGZYSXYGVUGCDL-HSZRJFAPSA-N |
| XLogP | 5.89 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.83 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|