C13H21ClN2O2 — CID 178006846
5-chloro-2-[(2R,6S)-2,6-dimethyloxan-4-yl]pyridazin-3-one;ethane (PubChem CID 178006846) has the molecular formula C13H21ClN2O2 and a molecular weight of 272.78 g/mol. Its IUPAC name is 5-chloro-2-[(2R,6S)-2,6-dimethyloxan-4-yl]pyridazin-3-one;ethane.
| Compound Name | 5-chloro-2-[(2R,6S)-2,6-dimethyloxan-4-yl]pyridazin-3-one;ethane |
|---|---|
| PubChem CID | 178006846 |
| Molecular Formula | C13H21ClN2O2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 5-chloro-2-[(2R,6S)-2,6-dimethyloxan-4-yl]pyridazin-3-one;ethane |
| SMILES | CC.C[C@@H]1CC(n2ncc(Cl)cc2=O)C[C@H](C)O1 |
| InChI | InChI=1S/C11H15ClN2O2.C2H6/c1-7-3-10(4-8(2)16-7)14-11(15)5-9(12)6-13-14;1-2/h5-8,10H,3-4H2,1-2H3;1-2H3/t7-,8+,10?; |
| InChIKey | FSIXKOYUDCXXRU-GWUVQLMMSA-N |
| XLogP | 3.05 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |