About 5-chloro-2-[(2R,6S)-2,6-dimethyloxan-4-yl]pyridazin-3-one;ethane
5-chloro-2-[(2R,6S)-2,6-dimethyloxan-4-yl]pyridazin-3-one;ethane (PubChem CID 178006846) has the molecular formula C13H21ClN2O2
and a molecular weight of 272.78 g/mol. Its IUPAC name is 5-chloro-2-[(2R,6S)-2,6-dimethyloxan-4-yl]pyridazin-3-one;ethane.
Molecular Properties
| Compound Name | 5-chloro-2-[(2R,6S)-2,6-dimethyloxan-4-yl]pyridazin-3-one;ethane |
| PubChem CID | 178006846 |
| Molecular Formula | C13H21ClN2O2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 5-chloro-2-[(2R,6S)-2,6-dimethyloxan-4-yl]pyridazin-3-one;ethane |
| SMILES | CC.C[C@@H]1CC(n2ncc(Cl)cc2=O)C[C@H](C)O1 |
| InChI | InChI=1S/C11H15ClN2O2.C2H6/c1-7-3-10(4-8(2)16-7)14-11(15)5-9(12)6-13-14;1-2/h5-8,10H,3-4H2,1-2H3;1-2H3/t7-,8+,10?; |
| InChIKey | FSIXKOYUDCXXRU-GWUVQLMMSA-N |
| XLogP | 3.05 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-2-[(2R,6S)-2,6-dimethyloxan-4-yl]pyridazin-3-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[(2R,6S)-2,6-dimethyloxan-4-yl]pyridazin-3-one;ethane?
The IUPAC name of 5-chloro-2-[(2R,6S)-2,6-dimethyloxan-4-yl]pyridazin-3-one;ethane (CID 178006846) is 5-chloro-2-[(2R,6S)-2,6-dimethyloxan-4-yl]pyridazin-3-one;ethane.
What is the SMILES notation for 5-chloro-2-[(2R,6S)-2,6-dimethyloxan-4-yl]pyridazin-3-one;ethane?
The canonical SMILES for 5-chloro-2-[(2R,6S)-2,6-dimethyloxan-4-yl]pyridazin-3-one;ethane is CC.C[C@@H]1CC(n2ncc(Cl)cc2=O)C[C@H](C)O1.
What is the InChIKey of 5-chloro-2-[(2R,6S)-2,6-dimethyloxan-4-yl]pyridazin-3-one;ethane?
The InChIKey is FSIXKOYUDCXXRU-GWUVQLMMSA-N. The full InChI is InChI=1S/C11H15ClN2O2.C2H6/c1-7-3-10(4-8(2)16-7)14-11(15)5-9(12)6-13-14;1-2/h5-8,10H,3-4H2,1-2H3;1-2H3/t7-,8+,10?;.
What are the key properties of 5-chloro-2-[(2R,6S)-2,6-dimethyloxan-4-yl]pyridazin-3-one;ethane?
5-chloro-2-[(2R,6S)-2,6-dimethyloxan-4-yl]pyridazin-3-one;ethane has a molecular weight of 272.78 g/mol, XLogP of 3.05, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[(2R,6S)-2,6-dimethyloxan-4-yl]pyridazin-3-one;ethane is sourced from PubChem (CID 178006846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).