About 2,5-dimethyl-1H-pyrazol-3-one;methoxymethane
2,5-dimethyl-1H-pyrazol-3-one;methoxymethane (PubChem CID 178007008) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2,5-dimethyl-1H-pyrazol-3-one;methoxymethane.
Molecular Properties
| Compound Name | 2,5-dimethyl-1H-pyrazol-3-one;methoxymethane |
| PubChem CID | 178007008 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 2,5-dimethyl-1H-pyrazol-3-one;methoxymethane |
| SMILES | COC.Cc1cc(=O)n(C)[nH]1 |
| InChI | InChI=1S/C5H8N2O.C2H6O/c1-4-3-5(8)7(2)6-4;1-3-2/h3,6H,1-2H3;1-2H3 |
| InChIKey | BYTHFTWDNJTFJE-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-dimethyl-1H-pyrazol-3-one;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1H-pyrazol-3-one;methoxymethane?
The IUPAC name of 2,5-dimethyl-1H-pyrazol-3-one;methoxymethane (CID 178007008) is 2,5-dimethyl-1H-pyrazol-3-one;methoxymethane.
What is the SMILES notation for 2,5-dimethyl-1H-pyrazol-3-one;methoxymethane?
The canonical SMILES for 2,5-dimethyl-1H-pyrazol-3-one;methoxymethane is COC.Cc1cc(=O)n(C)[nH]1.
What is the InChIKey of 2,5-dimethyl-1H-pyrazol-3-one;methoxymethane?
The InChIKey is BYTHFTWDNJTFJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O.C2H6O/c1-4-3-5(8)7(2)6-4;1-3-2/h3,6H,1-2H3;1-2H3.
What are the key properties of 2,5-dimethyl-1H-pyrazol-3-one;methoxymethane?
2,5-dimethyl-1H-pyrazol-3-one;methoxymethane has a molecular weight of 158.20 g/mol, XLogP of 0.28, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1H-pyrazol-3-one;methoxymethane is sourced from PubChem (CID 178007008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).