C27H23F3N6O3S2 — CID 178007299
1-[2,6-difluoro-3-(propylsulfanylamino)phenyl]-5-(4-fluorosulfonyloxy-N-methylanilino)-3-pyrimidin-5-ylpyrrolo[3,2-b]pyridine (PubChem CID 178007299) has the molecular formula C27H23F3N6O3S2 and a molecular weight of 600.65 g/mol. Its IUPAC name is 1-[2,6-difluoro-3-(propylsulfanylamino)phenyl]-5-(4-fluorosulfonyloxy-N-methylanilino)-3-pyrimidin-5-ylpyrrolo[3,2-b]pyridine.
| Compound Name | 1-[2,6-difluoro-3-(propylsulfanylamino)phenyl]-5-(4-fluorosulfonyloxy-N-methylanilino)-3-pyrimidin-5-ylpyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 178007299 |
| Molecular Formula | C27H23F3N6O3S2 |
| Molecular Weight | 600.65 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | 1-[2,6-difluoro-3-(propylsulfanylamino)phenyl]-5-(4-fluorosulfonyloxy-N-methylanilino)-3-pyrimidin-5-ylpyrrolo[3,2-b]pyridine |
| SMILES | CCCSNc1ccc(F)c(-n2cc(-c3cncnc3)c3nc(N(C)c4ccc(OS(=O)(=O)F)cc4)ccc32)c1F |
| InChI | InChI=1S/C27H23F3N6O3S2/c1-3-12-40-34-22-9-8-21(28)27(25(22)29)36-15-20(17-13-31-16-32-14-17)26-23(36)10-11-24(33-26)35(2)18-4-6-19(7-5-18)39-41(30,37)38/h4-11,13-16,34H,3,12H2,1-2H3 |
| InChIKey | BJCAXNXQPNGFCV-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.65 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|