C28H25F3N6O3S2 — CID 178007345
1-[2,6-difluoro-3-(propylsulfanylamino)phenyl]-5-[(3-fluorosulfonyloxyphenyl)methyl-methylamino]-3-pyrimidin-5-ylpyrrolo[3,2-b]pyridine (PubChem CID 178007345) has the molecular formula C28H25F3N6O3S2 and a molecular weight of 614.68 g/mol. Its IUPAC name is 1-[2,6-difluoro-3-(propylsulfanylamino)phenyl]-5-[(3-fluorosulfonyloxyphenyl)methyl-methylamino]-3-pyrimidin-5-ylpyrrolo[3,2-b]pyridine.
| Compound Name | 1-[2,6-difluoro-3-(propylsulfanylamino)phenyl]-5-[(3-fluorosulfonyloxyphenyl)methyl-methylamino]-3-pyrimidin-5-ylpyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 178007345 |
| Molecular Formula | C28H25F3N6O3S2 |
| Molecular Weight | 614.68 g/mol |
| Exact Mass | 614.14 |
| IUPAC Name | 1-[2,6-difluoro-3-(propylsulfanylamino)phenyl]-5-[(3-fluorosulfonyloxyphenyl)methyl-methylamino]-3-pyrimidin-5-ylpyrrolo[3,2-b]pyridine |
| SMILES | CCCSNc1ccc(F)c(-n2cc(-c3cncnc3)c3nc(N(C)Cc4cccc(OS(=O)(=O)F)c4)ccc32)c1F |
| InChI | InChI=1S/C28H25F3N6O3S2/c1-3-11-41-35-23-8-7-22(29)28(26(23)30)37-16-21(19-13-32-17-33-14-19)27-24(37)9-10-25(34-27)36(2)15-18-5-4-6-20(12-18)40-42(31,38)39/h4-10,12-14,16-17,35H,3,11,15H2,1-2H3 |
| InChIKey | QFCHJGXGWYCDPD-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.68 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|