C36H50N2O8 — CID 178007715
4-(5-acetyl-2-pyridinyl)-N-[1,3-bis(4-methyl-3-oxopentoxy)-2-[(4-methyl-3-oxopentoxy)methyl]propan-2-yl]benzamide (PubChem CID 178007715) has the molecular formula C36H50N2O8 and a molecular weight of 638.80 g/mol. Its IUPAC name is 4-(5-acetyl-2-pyridinyl)-N-[1,3-bis(4-methyl-3-oxopentoxy)-2-[(4-methyl-3-oxopentoxy)methyl]propan-2-yl]benzamide.
| Compound Name | 4-(5-acetyl-2-pyridinyl)-N-[1,3-bis(4-methyl-3-oxopentoxy)-2-[(4-methyl-3-oxopentoxy)methyl]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 178007715 |
| Molecular Formula | C36H50N2O8 |
| Molecular Weight | 638.80 g/mol |
| Exact Mass | 638.36 |
| IUPAC Name | 4-(5-acetyl-2-pyridinyl)-N-[1,3-bis(4-methyl-3-oxopentoxy)-2-[(4-methyl-3-oxopentoxy)methyl]propan-2-yl]benzamide |
| SMILES | CC(=O)c1ccc(-c2ccc(C(=O)NC(COCCC(=O)C(C)C)(COCCC(=O)C(C)C)COCCC(=O)C(C)C)cc2)nc1 |
| InChI | InChI=1S/C36H50N2O8/c1-24(2)32(40)14-17-44-21-36(22-45-18-15-33(41)25(3)4,23-46-19-16-34(42)26(5)6)38-35(43)29-10-8-28(9-11-29)31-13-12-30(20-37-31)27(7)39/h8-13,20,24-26H,14-19,21-23H2,1-7H3,(H,38,43) |
| InChIKey | MROIQNJFBQJKQU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 137.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.80 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|