About [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene;ethane
[(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene;ethane (PubChem CID 178007898) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene;ethane.
Molecular Properties
| Compound Name | [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene;ethane |
| PubChem CID | 178007898 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene;ethane |
| SMILES | C=C(C)/C=C(\N=N\C)C(C)C.CC |
| InChI | InChI=1S/C9H16N2.C2H6/c1-7(2)6-9(8(3)4)11-10-5;1-2/h6,8H,1H2,2-5H3;1-2H3/b9-6-,11-10+; |
| InChIKey | IFCHEURTTDOHDN-DIPLNALYSA-N |
| XLogP | 4.21 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene;ethane?
The IUPAC name of [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene;ethane (CID 178007898) is [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene;ethane.
What is the SMILES notation for [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene;ethane?
The canonical SMILES for [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene;ethane is C=C(C)/C=C(\N=N\C)C(C)C.CC.
What is the InChIKey of [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene;ethane?
The InChIKey is IFCHEURTTDOHDN-DIPLNALYSA-N. The full InChI is InChI=1S/C9H16N2.C2H6/c1-7(2)6-9(8(3)4)11-10-5;1-2/h6,8H,1H2,2-5H3;1-2H3/b9-6-,11-10+;.
What are the key properties of [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene;ethane?
[(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene;ethane has a molecular weight of 182.31 g/mol, XLogP of 4.21, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene;ethane is sourced from PubChem (CID 178007898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).