About [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene
[(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene (PubChem CID 178007899) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene.
Molecular Properties
| Compound Name | [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene |
| PubChem CID | 178007899 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene |
| SMILES | C=C(C)/C=C(\N=N\C)C(C)C |
| InChI | InChI=1S/C9H16N2/c1-7(2)6-9(8(3)4)11-10-5/h6,8H,1H2,2-5H3/b9-6-,11-10+ |
| InChIKey | PIPXWAVSGSINEA-KBCDKWTQSA-N |
| XLogP | 3.18 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene?
The IUPAC name of [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene (CID 178007899) is [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene.
What is the SMILES notation for [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene?
The canonical SMILES for [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene is C=C(C)/C=C(\N=N\C)C(C)C.
What is the InChIKey of [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene?
The InChIKey is PIPXWAVSGSINEA-KBCDKWTQSA-N. The full InChI is InChI=1S/C9H16N2/c1-7(2)6-9(8(3)4)11-10-5/h6,8H,1H2,2-5H3/b9-6-,11-10+.
What are the key properties of [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene?
[(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene has a molecular weight of 152.24 g/mol, XLogP of 3.18, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-methyldiazene is sourced from PubChem (CID 178007899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).