About 1-oxothiane-3,4-diol
1-oxothiane-3,4-diol (PubChem CID 178007988) has the molecular formula C5H10O3S
and a molecular weight of 150.20 g/mol. Its IUPAC name is 1-oxothiane-3,4-diol.
Molecular Properties
| Compound Name | 1-oxothiane-3,4-diol |
| PubChem CID | 178007988 |
| Molecular Formula | C5H10O3S |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 1-oxothiane-3,4-diol |
| SMILES | O=S1CCC(O)C(O)C1 |
| InChI | InChI=1S/C5H10O3S/c6-4-1-2-9(8)3-5(4)7/h4-7H,1-3H2 |
| InChIKey | DGOMQTVBPYHJJR-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-oxothiane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxothiane-3,4-diol?
The IUPAC name of 1-oxothiane-3,4-diol (CID 178007988) is 1-oxothiane-3,4-diol.
What is the SMILES notation for 1-oxothiane-3,4-diol?
The canonical SMILES for 1-oxothiane-3,4-diol is O=S1CCC(O)C(O)C1.
What is the InChIKey of 1-oxothiane-3,4-diol?
The InChIKey is DGOMQTVBPYHJJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3S/c6-4-1-2-9(8)3-5(4)7/h4-7H,1-3H2.
What are the key properties of 1-oxothiane-3,4-diol?
1-oxothiane-3,4-diol has a molecular weight of 150.20 g/mol, XLogP of -1.14, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxothiane-3,4-diol is sourced from PubChem (CID 178007988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).