C15H22F3NO3 — CID 178008105
2-methyl-6-(trifluoromethyl)pyridine;6-propan-2-yloxane-3,4-diol (PubChem CID 178008105) has the molecular formula C15H22F3NO3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 2-methyl-6-(trifluoromethyl)pyridine;6-propan-2-yloxane-3,4-diol.
| Compound Name | 2-methyl-6-(trifluoromethyl)pyridine;6-propan-2-yloxane-3,4-diol |
|---|---|
| PubChem CID | 178008105 |
| Molecular Formula | C15H22F3NO3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-methyl-6-(trifluoromethyl)pyridine;6-propan-2-yloxane-3,4-diol |
| SMILES | CC(C)C1CC(O)C(O)CO1.Cc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H16O3.C7H6F3N/c1-5(2)8-3-6(9)7(10)4-11-8;1-5-3-2-4-6(11-5)7(8,9)10/h5-10H,3-4H2,1-2H3;2-4H,1H3 |
| InChIKey | SEOSEQCSCFDUNX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |