About ethane;2-(ethoxymethyl)oxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] hypofluorite
ethane;2-(ethoxymethyl)oxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] hypofluorite (PubChem CID 178008147) has the molecular formula C15H24F4N2O5
and a molecular weight of 388.36 g/mol. Its IUPAC name is ethane;2-(ethoxymethyl)oxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] hypofluorite.
Molecular Properties
| Compound Name | ethane;2-(ethoxymethyl)oxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] hypofluorite |
| PubChem CID | 178008147 |
| Molecular Formula | C15H24F4N2O5 |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | ethane;2-(ethoxymethyl)oxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] hypofluorite |
| SMILES | CC.CCOCC1OCCC(O)C1O.FOc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H16O4.C5H2F4N2O.C2H6/c1-2-11-5-7-8(10)6(9)3-4-12-7;6-5(7,8)3-1-2-10-4(11-3)12-9;1-2/h6-10H,2-5H2,1H3;1-2H;1-2H3 |
| InChIKey | XJMOKKPRZKEYIS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethane;2-(ethoxymethyl)oxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(ethoxymethyl)oxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] hypofluorite?
The IUPAC name of ethane;2-(ethoxymethyl)oxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] hypofluorite (CID 178008147) is ethane;2-(ethoxymethyl)oxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] hypofluorite.
What is the SMILES notation for ethane;2-(ethoxymethyl)oxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] hypofluorite?
The canonical SMILES for ethane;2-(ethoxymethyl)oxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] hypofluorite is CC.CCOCC1OCCC(O)C1O.FOc1nccc(C(F)(F)F)n1.
What is the InChIKey of ethane;2-(ethoxymethyl)oxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] hypofluorite?
The InChIKey is XJMOKKPRZKEYIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O4.C5H2F4N2O.C2H6/c1-2-11-5-7-8(10)6(9)3-4-12-7;6-5(7,8)3-1-2-10-4(11-3)12-9;1-2/h6-10H,2-5H2,1H3;1-2H;1-2H3.
What are the key properties of ethane;2-(ethoxymethyl)oxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] hypofluorite?
ethane;2-(ethoxymethyl)oxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] hypofluorite has a molecular weight of 388.36 g/mol, XLogP of 2.32, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(ethoxymethyl)oxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] hypofluorite is sourced from PubChem (CID 178008147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).