C11H21N3S — CID 178008150
1-[1-(4-methylpentyl)triazol-4-yl]propane-2-thiol (PubChem CID 178008150) has the molecular formula C11H21N3S and a molecular weight of 227.38 g/mol. Its IUPAC name is 1-[1-(4-methylpentyl)triazol-4-yl]propane-2-thiol.
| Compound Name | 1-[1-(4-methylpentyl)triazol-4-yl]propane-2-thiol |
|---|---|
| PubChem CID | 178008150 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 1-[1-(4-methylpentyl)triazol-4-yl]propane-2-thiol |
| SMILES | CC(C)CCCn1cc(CC(C)S)nn1 |
| InChI | InChI=1S/C11H21N3S/c1-9(2)5-4-6-14-8-11(12-13-14)7-10(3)15/h8-10,15H,4-7H2,1-3H3 |
| InChIKey | LNYJFGCLSUKUQE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 30.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|