C20H41NO3 — CID 178008516
2,4-dimethylpentane;ethane;(Z)-N-(4-hydroxy-2-methylbutan-2-yl)-4-oxohex-2-enamide (PubChem CID 178008516) has the molecular formula C20H41NO3 and a molecular weight of 343.55 g/mol. Its IUPAC name is 2,4-dimethylpentane;ethane;(Z)-N-(4-hydroxy-2-methylbutan-2-yl)-4-oxohex-2-enamide.
| Compound Name | 2,4-dimethylpentane;ethane;(Z)-N-(4-hydroxy-2-methylbutan-2-yl)-4-oxohex-2-enamide |
|---|---|
| PubChem CID | 178008516 |
| Molecular Formula | C20H41NO3 |
| Molecular Weight | 343.55 g/mol |
| Exact Mass | 343.31 |
| IUPAC Name | 2,4-dimethylpentane;ethane;(Z)-N-(4-hydroxy-2-methylbutan-2-yl)-4-oxohex-2-enamide |
| SMILES | CC.CC(C)CC(C)C.CCC(=O)/C=C\C(=O)NC(C)(C)CCO |
| InChI | InChI=1S/C11H19NO3.C7H16.C2H6/c1-4-9(14)5-6-10(15)12-11(2,3)7-8-13;1-6(2)5-7(3)4;1-2/h5-6,13H,4,7-8H2,1-3H3,(H,12,15);6-7H,5H2,1-4H3;1-2H3/b6-5-;; |
| InChIKey | AMPZQAHTVKXYJR-XNOMRPDFSA-N |
| XLogP | 4.51 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|