C13H15F3N2O3S — CID 178008518
2-[[(3aR,7R,7aR)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxol-7-yl]oxy]-4-(trifluoromethyl)pyrimidine (PubChem CID 178008518) has the molecular formula C13H15F3N2O3S and a molecular weight of 336.34 g/mol. Its IUPAC name is 2-[[(3aR,7R,7aR)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxol-7-yl]oxy]-4-(trifluoromethyl)pyrimidine.
| Compound Name | 2-[[(3aR,7R,7aR)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxol-7-yl]oxy]-4-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 178008518 |
| Molecular Formula | C13H15F3N2O3S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-[[(3aR,7R,7aR)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxol-7-yl]oxy]-4-(trifluoromethyl)pyrimidine |
| SMILES | CC1(C)O[C@@H]2[C@@H](Oc3nccc(C(F)(F)F)n3)CSC[C@@H]2O1 |
| InChI | InChI=1S/C13H15F3N2O3S/c1-12(2)20-8-6-22-5-7(10(8)21-12)19-11-17-4-3-9(18-11)13(14,15)16/h3-4,7-8,10H,5-6H2,1-2H3/t7-,8-,10+/m0/s1 |
| InChIKey | JUPAAIHDPJODHT-OYNCUSHFSA-N |
| XLogP | 2.51 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |