C12H15F3N2O4 — CID 178008690
(2R,3R,4S,5R,6R)-2,6-dimethyl-5-[6-(trifluoromethyl)pyrazin-2-yl]oxyoxane-3,4-diol (PubChem CID 178008690) has the molecular formula C12H15F3N2O4 and a molecular weight of 308.26 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2,6-dimethyl-5-[6-(trifluoromethyl)pyrazin-2-yl]oxyoxane-3,4-diol.
| Compound Name | (2R,3R,4S,5R,6R)-2,6-dimethyl-5-[6-(trifluoromethyl)pyrazin-2-yl]oxyoxane-3,4-diol |
|---|---|
| PubChem CID | 178008690 |
| Molecular Formula | C12H15F3N2O4 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2,6-dimethyl-5-[6-(trifluoromethyl)pyrazin-2-yl]oxyoxane-3,4-diol |
| SMILES | C[C@H]1O[C@H](C)[C@H](Oc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H15F3N2O4/c1-5-9(18)10(19)11(6(2)20-5)21-8-4-16-3-7(17-8)12(13,14)15/h3-6,9-11,18-19H,1-2H3/t5-,6-,9+,10+,11+/m1/s1 |
| InChIKey | PYYQHWZZIKZONZ-DBTXQKCHSA-N |
| XLogP | 0.77 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |