C8H17NS — CID 178008911
2-(ethylsulfanylmethyl)-1,4-dimethylazetidine (PubChem CID 178008911) has the molecular formula C8H17NS and a molecular weight of 159.30 g/mol. Its IUPAC name is 2-(ethylsulfanylmethyl)-1,4-dimethylazetidine.
| Compound Name | 2-(ethylsulfanylmethyl)-1,4-dimethylazetidine |
|---|---|
| PubChem CID | 178008911 |
| Molecular Formula | C8H17NS |
| Molecular Weight | 159.30 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | 2-(ethylsulfanylmethyl)-1,4-dimethylazetidine |
| SMILES | CCSCC1CC(C)N1C |
| InChI | InChI=1S/C8H17NS/c1-4-10-6-8-5-7(2)9(8)3/h7-8H,4-6H2,1-3H3 |
| InChIKey | NVJXNYZNUDMCNA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |