About 4-butylthieno[3,2-d]pyrimidine
4-butylthieno[3,2-d]pyrimidine (PubChem CID 178009105) has the molecular formula C10H12N2S
and a molecular weight of 192.29 g/mol. Its IUPAC name is 4-butylthieno[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 4-butylthieno[3,2-d]pyrimidine |
| PubChem CID | 178009105 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 4-butylthieno[3,2-d]pyrimidine |
| SMILES | CCCCc1ncnc2ccsc12 |
| InChI | InChI=1S/C10H12N2S/c1-2-3-4-8-10-9(5-6-13-10)12-7-11-8/h5-7H,2-4H2,1H3 |
| InChIKey | FLMHESRVJUKUBY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-butylthieno[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylthieno[3,2-d]pyrimidine?
The IUPAC name of 4-butylthieno[3,2-d]pyrimidine (CID 178009105) is 4-butylthieno[3,2-d]pyrimidine.
What is the SMILES notation for 4-butylthieno[3,2-d]pyrimidine?
The canonical SMILES for 4-butylthieno[3,2-d]pyrimidine is CCCCc1ncnc2ccsc12.
What is the InChIKey of 4-butylthieno[3,2-d]pyrimidine?
The InChIKey is FLMHESRVJUKUBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2S/c1-2-3-4-8-10-9(5-6-13-10)12-7-11-8/h5-7H,2-4H2,1H3.
What are the key properties of 4-butylthieno[3,2-d]pyrimidine?
4-butylthieno[3,2-d]pyrimidine has a molecular weight of 192.29 g/mol, XLogP of 3.03, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylthieno[3,2-d]pyrimidine is sourced from PubChem (CID 178009105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).