About 1-(2-methylpyrimidin-4-yl)ethyl ethanesulfinate
1-(2-methylpyrimidin-4-yl)ethyl ethanesulfinate (PubChem CID 178009330) has the molecular formula C9H14N2O2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is 1-(2-methylpyrimidin-4-yl)ethyl ethanesulfinate.
Molecular Properties
| Compound Name | 1-(2-methylpyrimidin-4-yl)ethyl ethanesulfinate |
| PubChem CID | 178009330 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 1-(2-methylpyrimidin-4-yl)ethyl ethanesulfinate |
| SMILES | CCS(=O)OC(C)c1ccnc(C)n1 |
| InChI | InChI=1S/C9H14N2O2S/c1-4-14(12)13-7(2)9-5-6-10-8(3)11-9/h5-7H,4H2,1-3H3 |
| InChIKey | BIYXOOZMWNZURC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-methylpyrimidin-4-yl)ethyl ethanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylpyrimidin-4-yl)ethyl ethanesulfinate?
The IUPAC name of 1-(2-methylpyrimidin-4-yl)ethyl ethanesulfinate (CID 178009330) is 1-(2-methylpyrimidin-4-yl)ethyl ethanesulfinate.
What is the SMILES notation for 1-(2-methylpyrimidin-4-yl)ethyl ethanesulfinate?
The canonical SMILES for 1-(2-methylpyrimidin-4-yl)ethyl ethanesulfinate is CCS(=O)OC(C)c1ccnc(C)n1.
What is the InChIKey of 1-(2-methylpyrimidin-4-yl)ethyl ethanesulfinate?
The InChIKey is BIYXOOZMWNZURC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S/c1-4-14(12)13-7(2)9-5-6-10-8(3)11-9/h5-7H,4H2,1-3H3.
What are the key properties of 1-(2-methylpyrimidin-4-yl)ethyl ethanesulfinate?
1-(2-methylpyrimidin-4-yl)ethyl ethanesulfinate has a molecular weight of 214.29 g/mol, XLogP of 1.55, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylpyrimidin-4-yl)ethyl ethanesulfinate is sourced from PubChem (CID 178009330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).