C12H20N2 — CID 178009376
1-[(6-methylcyclohexa-1,5-dien-1-yl)methyl]piperazine (PubChem CID 178009376) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-[(6-methylcyclohexa-1,5-dien-1-yl)methyl]piperazine.
| Compound Name | 1-[(6-methylcyclohexa-1,5-dien-1-yl)methyl]piperazine |
|---|---|
| PubChem CID | 178009376 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-[(6-methylcyclohexa-1,5-dien-1-yl)methyl]piperazine |
| SMILES | CC1=CCCC=C1CN1CCNCC1 |
| InChI | InChI=1S/C12H20N2/c1-11-4-2-3-5-12(11)10-14-8-6-13-7-9-14/h4-5,13H,2-3,6-10H2,1H3 |
| InChIKey | SGKHACSFWHVZQH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |