C20H18ClF2N5O2 — CID 178009493
8-(3-chloro-2,4-difluorophenyl)-5-[(E)-2-morpholin-4-ylprop-1-enoxy]pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 178009493) has the molecular formula C20H18ClF2N5O2 and a molecular weight of 433.85 g/mol. Its IUPAC name is 8-(3-chloro-2,4-difluorophenyl)-5-[(E)-2-morpholin-4-ylprop-1-enoxy]pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 8-(3-chloro-2,4-difluorophenyl)-5-[(E)-2-morpholin-4-ylprop-1-enoxy]pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 178009493 |
| Molecular Formula | C20H18ClF2N5O2 |
| Molecular Weight | 433.85 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 8-(3-chloro-2,4-difluorophenyl)-5-[(E)-2-morpholin-4-ylprop-1-enoxy]pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | C/C(=C\Oc1cnc(-c2ccc(F)c(Cl)c2F)c2ncnc(N)c12)N1CCOCC1 |
| InChI | InChI=1S/C20H18ClF2N5O2/c1-11(28-4-6-29-7-5-28)9-30-14-8-25-18(19-15(14)20(24)27-10-26-19)12-2-3-13(22)16(21)17(12)23/h2-3,8-10H,4-7H2,1H3,(H2,24,26,27)/b11-9+ |
| InChIKey | KTKPKKYCKWEQSV-PKNBQFBNSA-N |
| XLogP | 3.78 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.85 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|