About 3-ethyl-4-fluoro-1-methyl-3,6-dihydro-2H-pyridine;propane
3-ethyl-4-fluoro-1-methyl-3,6-dihydro-2H-pyridine;propane (PubChem CID 178009673) has the molecular formula C11H22FN
and a molecular weight of 187.30 g/mol. Its IUPAC name is 3-ethyl-4-fluoro-1-methyl-3,6-dihydro-2H-pyridine;propane.
Molecular Properties
| Compound Name | 3-ethyl-4-fluoro-1-methyl-3,6-dihydro-2H-pyridine;propane |
| PubChem CID | 178009673 |
| Molecular Formula | C11H22FN |
| Molecular Weight | 187.30 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | 3-ethyl-4-fluoro-1-methyl-3,6-dihydro-2H-pyridine;propane |
| SMILES | CCC.CCC1CN(C)CC=C1F |
| InChI | InChI=1S/C8H14FN.C3H8/c1-3-7-6-10(2)5-4-8(7)9;1-3-2/h4,7H,3,5-6H2,1-2H3;3H2,1-2H3 |
| InChIKey | PLXYJCQWGQTHOH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-4-fluoro-1-methyl-3,6-dihydro-2H-pyridine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4-fluoro-1-methyl-3,6-dihydro-2H-pyridine;propane?
The IUPAC name of 3-ethyl-4-fluoro-1-methyl-3,6-dihydro-2H-pyridine;propane (CID 178009673) is 3-ethyl-4-fluoro-1-methyl-3,6-dihydro-2H-pyridine;propane.
What is the SMILES notation for 3-ethyl-4-fluoro-1-methyl-3,6-dihydro-2H-pyridine;propane?
The canonical SMILES for 3-ethyl-4-fluoro-1-methyl-3,6-dihydro-2H-pyridine;propane is CCC.CCC1CN(C)CC=C1F.
What is the InChIKey of 3-ethyl-4-fluoro-1-methyl-3,6-dihydro-2H-pyridine;propane?
The InChIKey is PLXYJCQWGQTHOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14FN.C3H8/c1-3-7-6-10(2)5-4-8(7)9;1-3-2/h4,7H,3,5-6H2,1-2H3;3H2,1-2H3.
What are the key properties of 3-ethyl-4-fluoro-1-methyl-3,6-dihydro-2H-pyridine;propane?
3-ethyl-4-fluoro-1-methyl-3,6-dihydro-2H-pyridine;propane has a molecular weight of 187.30 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4-fluoro-1-methyl-3,6-dihydro-2H-pyridine;propane is sourced from PubChem (CID 178009673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).